About phenyl (4-prop-1-en-2-ylphenyl) carbonate
phenyl (4-prop-1-en-2-ylphenyl) carbonate (PubChem CID 154230592) has the molecular formula C16H14O3
and a molecular weight of 254.28 g/mol. Its IUPAC name is phenyl (4-prop-1-en-2-ylphenyl) carbonate.
Molecular Properties
| Compound Name | phenyl (4-prop-1-en-2-ylphenyl) carbonate |
| PubChem CID | 154230592 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | phenyl (4-prop-1-en-2-ylphenyl) carbonate |
| SMILES | C=C(C)c1ccc(OC(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C16H14O3/c1-12(2)13-8-10-15(11-9-13)19-16(17)18-14-6-4-3-5-7-14/h3-11H,1H2,2H3 |
| InChIKey | WIBKRHJKMQDZNA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze phenyl (4-prop-1-en-2-ylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl (4-prop-1-en-2-ylphenyl) carbonate?
The IUPAC name of phenyl (4-prop-1-en-2-ylphenyl) carbonate (CID 154230592) is phenyl (4-prop-1-en-2-ylphenyl) carbonate.
What is the SMILES notation for phenyl (4-prop-1-en-2-ylphenyl) carbonate?
The canonical SMILES for phenyl (4-prop-1-en-2-ylphenyl) carbonate is C=C(C)c1ccc(OC(=O)Oc2ccccc2)cc1.
What is the InChIKey of phenyl (4-prop-1-en-2-ylphenyl) carbonate?
The InChIKey is WIBKRHJKMQDZNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3/c1-12(2)13-8-10-15(11-9-13)19-16(17)18-14-6-4-3-5-7-14/h3-11H,1H2,2H3.
What are the key properties of phenyl (4-prop-1-en-2-ylphenyl) carbonate?
phenyl (4-prop-1-en-2-ylphenyl) carbonate has a molecular weight of 254.28 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl (4-prop-1-en-2-ylphenyl) carbonate is sourced from PubChem (CID 154230592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).