About S-amino 2-phenoxyprop-2-enethioate
S-amino 2-phenoxyprop-2-enethioate (PubChem CID 152902947) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is S-amino 2-phenoxyprop-2-enethioate.
Molecular Properties
| Compound Name | S-amino 2-phenoxyprop-2-enethioate |
| PubChem CID | 152902947 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | S-amino 2-phenoxyprop-2-enethioate |
| SMILES | C=C(Oc1ccccc1)C(=O)SN |
| InChI | InChI=1S/C9H9NO2S/c1-7(9(11)13-10)12-8-5-3-2-4-6-8/h2-6H,1,10H2 |
| InChIKey | UFROPWLTEDTWOX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-amino 2-phenoxyprop-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-amino 2-phenoxyprop-2-enethioate?
The IUPAC name of S-amino 2-phenoxyprop-2-enethioate (CID 152902947) is S-amino 2-phenoxyprop-2-enethioate.
What is the SMILES notation for S-amino 2-phenoxyprop-2-enethioate?
The canonical SMILES for S-amino 2-phenoxyprop-2-enethioate is C=C(Oc1ccccc1)C(=O)SN.
What is the InChIKey of S-amino 2-phenoxyprop-2-enethioate?
The InChIKey is UFROPWLTEDTWOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c1-7(9(11)13-10)12-8-5-3-2-4-6-8/h2-6H,1,10H2.
What are the key properties of S-amino 2-phenoxyprop-2-enethioate?
S-amino 2-phenoxyprop-2-enethioate has a molecular weight of 195.24 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-amino 2-phenoxyprop-2-enethioate is sourced from PubChem (CID 152902947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).