About (2-chlorophenyl) nitrate
(2-chlorophenyl) nitrate (PubChem CID 141071843) has the molecular formula C6H4ClNO3
and a molecular weight of 173.56 g/mol. Its IUPAC name is (2-chlorophenyl) nitrate.
Molecular Properties
| Compound Name | (2-chlorophenyl) nitrate |
| PubChem CID | 141071843 |
| Molecular Formula | C6H4ClNO3 |
| Molecular Weight | 173.56 g/mol |
| Exact Mass | 172.99 |
| IUPAC Name | (2-chlorophenyl) nitrate |
| SMILES | O=[N+]([O-])Oc1ccccc1Cl |
| InChI | InChI=1S/C6H4ClNO3/c7-5-3-1-2-4-6(5)11-8(9)10/h1-4H |
| InChIKey | ZDVFRZZLBPIAKC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl) nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl) nitrate?
The IUPAC name of (2-chlorophenyl) nitrate (CID 141071843) is (2-chlorophenyl) nitrate.
What is the SMILES notation for (2-chlorophenyl) nitrate?
The canonical SMILES for (2-chlorophenyl) nitrate is O=[N+]([O-])Oc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl) nitrate?
The InChIKey is ZDVFRZZLBPIAKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO3/c7-5-3-1-2-4-6(5)11-8(9)10/h1-4H.
What are the key properties of (2-chlorophenyl) nitrate?
(2-chlorophenyl) nitrate has a molecular weight of 173.56 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl) nitrate is sourced from PubChem (CID 141071843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).