About benzoic acid;(2-hydroxyphenyl) nitrate
benzoic acid;(2-hydroxyphenyl) nitrate (PubChem CID 174507477) has the molecular formula C13H11NO6
and a molecular weight of 277.23 g/mol. Its IUPAC name is benzoic acid;(2-hydroxyphenyl) nitrate.
Molecular Properties
| Compound Name | benzoic acid;(2-hydroxyphenyl) nitrate |
| PubChem CID | 174507477 |
| Molecular Formula | C13H11NO6 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | benzoic acid;(2-hydroxyphenyl) nitrate |
| SMILES | O=C(O)c1ccccc1.O=[N+]([O-])Oc1ccccc1O |
| InChI | InChI=1S/C7H6O2.C6H5NO4/c8-7(9)6-4-2-1-3-5-6;8-5-3-1-2-4-6(5)11-7(9)10/h1-5H,(H,8,9);1-4,8H |
| InChIKey | OUEPKHYGYHQNIN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;(2-hydroxyphenyl) nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;(2-hydroxyphenyl) nitrate?
The IUPAC name of benzoic acid;(2-hydroxyphenyl) nitrate (CID 174507477) is benzoic acid;(2-hydroxyphenyl) nitrate.
What is the SMILES notation for benzoic acid;(2-hydroxyphenyl) nitrate?
The canonical SMILES for benzoic acid;(2-hydroxyphenyl) nitrate is O=C(O)c1ccccc1.O=[N+]([O-])Oc1ccccc1O.
What is the InChIKey of benzoic acid;(2-hydroxyphenyl) nitrate?
The InChIKey is OUEPKHYGYHQNIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H5NO4/c8-7(9)6-4-2-1-3-5-6;8-5-3-1-2-4-6(5)11-7(9)10/h1-5H,(H,8,9);1-4,8H.
What are the key properties of benzoic acid;(2-hydroxyphenyl) nitrate?
benzoic acid;(2-hydroxyphenyl) nitrate has a molecular weight of 277.23 g/mol, XLogP of 2.35, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;(2-hydroxyphenyl) nitrate is sourced from PubChem (CID 174507477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).