About (3-bromophenyl) nitrate;guanidine
(3-bromophenyl) nitrate;guanidine (PubChem CID 68942004) has the molecular formula C7H9BrN4O3
and a molecular weight of 277.08 g/mol. Its IUPAC name is (3-bromophenyl) nitrate;guanidine.
Molecular Properties
| Compound Name | (3-bromophenyl) nitrate;guanidine |
| PubChem CID | 68942004 |
| Molecular Formula | C7H9BrN4O3 |
| Molecular Weight | 277.08 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | (3-bromophenyl) nitrate;guanidine |
| SMILES | O=[N+]([O-])Oc1cccc(Br)c1.[H]N=C(N)N |
| InChI | InChI=1S/C6H4BrNO3.CH5N3/c7-5-2-1-3-6(4-5)11-8(9)10;2-1(3)4/h1-4H;(H5,2,3,4) |
| InChIKey | JWFZFDWVLWBKLB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.08 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-bromophenyl) nitrate;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl) nitrate;guanidine?
The IUPAC name of (3-bromophenyl) nitrate;guanidine (CID 68942004) is (3-bromophenyl) nitrate;guanidine.
What is the SMILES notation for (3-bromophenyl) nitrate;guanidine?
The canonical SMILES for (3-bromophenyl) nitrate;guanidine is O=[N+]([O-])Oc1cccc(Br)c1.[H]N=C(N)N.
What is the InChIKey of (3-bromophenyl) nitrate;guanidine?
The InChIKey is JWFZFDWVLWBKLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrNO3.CH5N3/c7-5-2-1-3-6(4-5)11-8(9)10;2-1(3)4/h1-4H;(H5,2,3,4).
What are the key properties of (3-bromophenyl) nitrate;guanidine?
(3-bromophenyl) nitrate;guanidine has a molecular weight of 277.08 g/mol, XLogP of 0.86, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl) nitrate;guanidine is sourced from PubChem (CID 68942004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).