About CID 57202540
CID 57202540 (PubChem CID 57202540) has the molecular formula C12H8BBr2O2
and a molecular weight of 354.81 g/mol.
Molecular Properties
| Compound Name | CID 57202540 |
| PubChem CID | 57202540 |
| Molecular Formula | C12H8BBr2O2 |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 352.90 |
| IUPAC Name | — |
| SMILES | Brc1cccc(O[B]Oc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C12H8BBr2O2/c14-9-3-1-5-11(7-9)16-13-17-12-6-2-4-10(15)8-12/h1-8H |
| InChIKey | GFQZEPNOCHHPKE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57202540 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57202540?
The IUPAC name of CID 57202540 (CID 57202540) is not available.
What is the SMILES notation for CID 57202540?
The canonical SMILES for CID 57202540 is Brc1cccc(O[B]Oc2cccc(Br)c2)c1.
What is the InChIKey of CID 57202540?
The InChIKey is GFQZEPNOCHHPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BBr2O2/c14-9-3-1-5-11(7-9)16-13-17-12-6-2-4-10(15)8-12/h1-8H.
What are the key properties of CID 57202540?
CID 57202540 has a molecular weight of 354.81 g/mol, XLogP of 4.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57202540 is sourced from PubChem (CID 57202540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).