About (4-sulfanylphenyl) nitrate
(4-sulfanylphenyl) nitrate (PubChem CID 126638144) has the molecular formula C6H5NO3S
and a molecular weight of 171.18 g/mol. Its IUPAC name is (4-sulfanylphenyl) nitrate.
Molecular Properties
| Compound Name | (4-sulfanylphenyl) nitrate |
| PubChem CID | 126638144 |
| Molecular Formula | C6H5NO3S |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.00 |
| IUPAC Name | (4-sulfanylphenyl) nitrate |
| SMILES | O=[N+]([O-])Oc1ccc(S)cc1 |
| InChI | InChI=1S/C6H5NO3S/c8-7(9)10-5-1-3-6(11)4-2-5/h1-4,11H |
| InChIKey | XDUYKGSFQQJDDR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-sulfanylphenyl) nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-sulfanylphenyl) nitrate?
The IUPAC name of (4-sulfanylphenyl) nitrate (CID 126638144) is (4-sulfanylphenyl) nitrate.
What is the SMILES notation for (4-sulfanylphenyl) nitrate?
The canonical SMILES for (4-sulfanylphenyl) nitrate is O=[N+]([O-])Oc1ccc(S)cc1.
What is the InChIKey of (4-sulfanylphenyl) nitrate?
The InChIKey is XDUYKGSFQQJDDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3S/c8-7(9)10-5-1-3-6(11)4-2-5/h1-4,11H.
What are the key properties of (4-sulfanylphenyl) nitrate?
(4-sulfanylphenyl) nitrate has a molecular weight of 171.18 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-sulfanylphenyl) nitrate is sourced from PubChem (CID 126638144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).