About 2-nitro-5-sulfanylphenol
2-nitro-5-sulfanylphenol (PubChem CID 57204619) has the molecular formula C6H5NO3S
and a molecular weight of 171.18 g/mol. Its IUPAC name is 2-nitro-5-sulfanylphenol.
Molecular Properties
| Compound Name | 2-nitro-5-sulfanylphenol |
| PubChem CID | 57204619 |
| Molecular Formula | C6H5NO3S |
| Molecular Weight | 171.18 g/mol |
| Exact Mass | 171.00 |
| IUPAC Name | 2-nitro-5-sulfanylphenol |
| SMILES | O=[N+]([O-])c1ccc(S)cc1O |
| InChI | InChI=1S/C6H5NO3S/c8-6-3-4(11)1-2-5(6)7(9)10/h1-3,8,11H |
| InChIKey | BDFDUQZJUVRHGA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-5-sulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-5-sulfanylphenol?
The IUPAC name of 2-nitro-5-sulfanylphenol (CID 57204619) is 2-nitro-5-sulfanylphenol.
What is the SMILES notation for 2-nitro-5-sulfanylphenol?
The canonical SMILES for 2-nitro-5-sulfanylphenol is O=[N+]([O-])c1ccc(S)cc1O.
What is the InChIKey of 2-nitro-5-sulfanylphenol?
The InChIKey is BDFDUQZJUVRHGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3S/c8-6-3-4(11)1-2-5(6)7(9)10/h1-3,8,11H.
What are the key properties of 2-nitro-5-sulfanylphenol?
2-nitro-5-sulfanylphenol has a molecular weight of 171.18 g/mol, XLogP of 1.59, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-5-sulfanylphenol is sourced from PubChem (CID 57204619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).