About (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate
(2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate (PubChem CID 166436401) has the molecular formula C13H9NO6S
and a molecular weight of 307.28 g/mol. Its IUPAC name is (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate.
Molecular Properties
| Compound Name | (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate |
| PubChem CID | 166436401 |
| Molecular Formula | C13H9NO6S |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate |
| SMILES | O=C(Oc1cc(O)ccc1O)c1cc(S)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9NO6S/c15-7-1-4-11(16)12(5-7)20-13(17)9-6-8(21)2-3-10(9)14(18)19/h1-6,15-16,21H |
| InChIKey | KPIFALWFJVXKLQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate?
The IUPAC name of (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate (CID 166436401) is (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate.
What is the SMILES notation for (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate?
The canonical SMILES for (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate is O=C(Oc1cc(O)ccc1O)c1cc(S)ccc1[N+](=O)[O-].
What is the InChIKey of (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate?
The InChIKey is KPIFALWFJVXKLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO6S/c15-7-1-4-11(16)12(5-7)20-13(17)9-6-8(21)2-3-10(9)14(18)19/h1-6,15-16,21H.
What are the key properties of (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate?
(2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate has a molecular weight of 307.28 g/mol, XLogP of 2.51, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxyphenyl) 2-nitro-5-sulfanylbenzoate is sourced from PubChem (CID 166436401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).