C14H10O7 — CID 54530363
2-(2,4-dihydroxybenzoyl)oxy-4-hydroxybenzoic acid (PubChem CID 54530363) has the molecular formula C14H10O7 and a molecular weight of 290.23 g/mol. Its IUPAC name is 2-(2,4-dihydroxybenzoyl)oxy-4-hydroxybenzoic acid.
| Compound Name | 2-(2,4-dihydroxybenzoyl)oxy-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 54530363 |
| Molecular Formula | C14H10O7 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-(2,4-dihydroxybenzoyl)oxy-4-hydroxybenzoic acid |
| SMILES | O=C(Oc1cc(O)ccc1C(=O)O)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H10O7/c15-7-1-3-9(11(17)5-7)14(20)21-12-6-8(16)2-4-10(12)13(18)19/h1-6,15-17H,(H,18,19) |
| InChIKey | YWCBREOBHKNYIW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|