About 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid
3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid (PubChem CID 123164548) has the molecular formula C22H14O7
and a molecular weight of 390.35 g/mol. Its IUPAC name is 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid |
| PubChem CID | 123164548 |
| Molecular Formula | C22H14O7 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid |
| SMILES | O=C(Oc1cc2ccc(O)cc2cc1C(=O)O)c1cc2cc(O)ccc2cc1O |
| InChI | InChI=1S/C22H14O7/c23-15-3-1-11-9-19(25)17(7-13(11)5-15)22(28)29-20-10-12-2-4-16(24)6-14(12)8-18(20)21(26)27/h1-10,23-25H,(H,26,27) |
| InChIKey | AZHHIPPVJFLVFI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid?
The IUPAC name of 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid (CID 123164548) is 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid.
What is the SMILES notation for 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid?
The canonical SMILES for 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid is O=C(Oc1cc2ccc(O)cc2cc1C(=O)O)c1cc2cc(O)ccc2cc1O.
What is the InChIKey of 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid?
The InChIKey is AZHHIPPVJFLVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14O7/c23-15-3-1-11-9-19(25)17(7-13(11)5-15)22(28)29-20-10-12-2-4-16(24)6-14(12)8-18(20)21(26)27/h1-10,23-25H,(H,26,27).
What are the key properties of 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid?
3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid has a molecular weight of 390.35 g/mol, XLogP of 4.03, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,7-dihydroxynaphthalene-2-carbonyl)oxy-7-hydroxynaphthalene-2-carboxylic acid is sourced from PubChem (CID 123164548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).