C14H10O8 — CID 57113507
5-hydroxy-2-(2,4,6-trihydroxybenzoyl)oxybenzoic acid (PubChem CID 57113507) has the molecular formula C14H10O8 and a molecular weight of 306.23 g/mol. Its IUPAC name is 5-hydroxy-2-(2,4,6-trihydroxybenzoyl)oxybenzoic acid.
| Compound Name | 5-hydroxy-2-(2,4,6-trihydroxybenzoyl)oxybenzoic acid |
|---|---|
| PubChem CID | 57113507 |
| Molecular Formula | C14H10O8 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 5-hydroxy-2-(2,4,6-trihydroxybenzoyl)oxybenzoic acid |
| SMILES | O=C(O)c1cc(O)ccc1OC(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C14H10O8/c15-6-1-2-11(8(3-6)13(19)20)22-14(21)12-9(17)4-7(16)5-10(12)18/h1-5,15-18H,(H,19,20) |
| InChIKey | HOZVHOMVHLQPEE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|