4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid

C16H10O8 — CID 70551484

IUPAC4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid
SMILESO=C(O)c1ccc(C(=O)Oc2ccc(C(=O)O)cc2C(=O)O)cc1
InChIInChI=1S/C16H10O8/c17-13(18)8-1-3-9(4-2-8)16(23)24-12-6-5-10(14(19)20)7-11(12)15(21)22/h1-7H,(H,17,18)(H,19,20)(H,21,22)
InChIKeyOWULGERDSISQOR-UHFFFAOYSA-N
MW330.25 g/mol
LogP2.00
Rot. Bonds5

About 4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid

4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid (PubChem CID 70551484) has the molecular formula C16H10O8 and a molecular weight of 330.25 g/mol. Its IUPAC name is 4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid
PubChem CID70551484
Molecular FormulaC16H10O8
Molecular Weight330.25 g/mol
Exact Mass330.04
IUPAC Name4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid
SMILESO=C(O)c1ccc(C(=O)Oc2ccc(C(=O)O)cc2C(=O)O)cc1
InChIInChI=1S/C16H10O8/c17-13(18)8-1-3-9(4-2-8)16(23)24-12-6-5-10(14(19)20)7-11(12)15(21)22/h1-7H,(H,17,18)(H,19,20)(H,21,22)
InChIKeyOWULGERDSISQOR-UHFFFAOYSA-N
XLogP2.00
TPSA138.20 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.25
LogP ≤ 52.00
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid?
The IUPAC name of 4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid (CID 70551484) is 4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid is O=C(O)c1ccc(C(=O)Oc2ccc(C(=O)O)cc2C(=O)O)cc1.
What is the InChIKey of 4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid?
The InChIKey is OWULGERDSISQOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O8/c17-13(18)8-1-3-9(4-2-8)16(23)24-12-6-5-10(14(19)20)7-11(12)15(21)22/h1-7H,(H,17,18)(H,19,20)(H,21,22).
What are the key properties of 4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid?
4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid has a molecular weight of 330.25 g/mol, XLogP of 2.00, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-carboxybenzoyl)oxybenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 70551484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).