4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid

C16H10O9 — CID 122207296

IUPAC4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid
SMILESO=C(O)c1ccc(Oc2ccc(C(=O)O)c(C(=O)O)c2)c(C(=O)O)c1
InChIInChI=1S/C16H10O9/c17-13(18)7-1-4-12(11(5-7)16(23)24)25-8-2-3-9(14(19)20)10(6-8)15(21)22/h1-6H,(H,17,18)(H,19,20)(H,21,22)(H,23,24)
InChIKeyAUBPDCNOKXDUSD-UHFFFAOYSA-N
MW346.25 g/mol
LogP2.27
Rot. Bonds6

About 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid

4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid (PubChem CID 122207296) has the molecular formula C16H10O9 and a molecular weight of 346.25 g/mol. Its IUPAC name is 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid
PubChem CID122207296
Molecular FormulaC16H10O9
Molecular Weight346.25 g/mol
Exact Mass346.03
IUPAC Name4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid
SMILESO=C(O)c1ccc(Oc2ccc(C(=O)O)c(C(=O)O)c2)c(C(=O)O)c1
InChIInChI=1S/C16H10O9/c17-13(18)7-1-4-12(11(5-7)16(23)24)25-8-2-3-9(14(19)20)10(6-8)15(21)22/h1-6H,(H,17,18)(H,19,20)(H,21,22)(H,23,24)
InChIKeyAUBPDCNOKXDUSD-UHFFFAOYSA-N
XLogP2.27
TPSA158.43 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.25
LogP ≤ 52.27
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid?
The IUPAC name of 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid (CID 122207296) is 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid is O=C(O)c1ccc(Oc2ccc(C(=O)O)c(C(=O)O)c2)c(C(=O)O)c1.
What is the InChIKey of 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid?
The InChIKey is AUBPDCNOKXDUSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O9/c17-13(18)7-1-4-12(11(5-7)16(23)24)25-8-2-3-9(14(19)20)10(6-8)15(21)22/h1-6H,(H,17,18)(H,19,20)(H,21,22)(H,23,24).
What are the key properties of 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid?
4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid has a molecular weight of 346.25 g/mol, XLogP of 2.27, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 122207296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).