C16H10O9 — CID 122207296
4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid (PubChem CID 122207296) has the molecular formula C16H10O9 and a molecular weight of 346.25 g/mol. Its IUPAC name is 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid.
| Compound Name | 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 122207296 |
| Molecular Formula | C16H10O9 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 4-(3,4-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(Oc2ccc(C(=O)O)c(C(=O)O)c2)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H10O9/c17-13(18)7-1-4-12(11(5-7)16(23)24)25-8-2-3-9(14(19)20)10(6-8)15(21)22/h1-6H,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | AUBPDCNOKXDUSD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |