C13H18O10 — CID 19102454
benzene-1,2,4-tricarboxylic acid;bis(ethane-1,2-diol) (PubChem CID 19102454) has the molecular formula C13H18O10 and a molecular weight of 334.28 g/mol. Its IUPAC name is benzene-1,2,4-tricarboxylic acid;bis(ethane-1,2-diol).
| Compound Name | benzene-1,2,4-tricarboxylic acid;bis(ethane-1,2-diol) |
|---|---|
| PubChem CID | 19102454 |
| Molecular Formula | C13H18O10 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | benzene-1,2,4-tricarboxylic acid;bis(ethane-1,2-diol) |
| SMILES | O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1.OCCO.OCCO |
| InChI | InChI=1S/C9H6O6.2C2H6O2/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;2*3-1-2-4/h1-3H,(H,10,11)(H,12,13)(H,14,15);2*3-4H,1-2H2 |
| InChIKey | NMSRRNWLNMYBPT-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |