C19H22O14 — CID 70425971
benzene-1,2,4-tricarboxylic acid;butanedioic acid;hexanedioic acid (PubChem CID 70425971) has the molecular formula C19H22O14 and a molecular weight of 474.37 g/mol. Its IUPAC name is benzene-1,2,4-tricarboxylic acid;butanedioic acid;hexanedioic acid.
| Compound Name | benzene-1,2,4-tricarboxylic acid;butanedioic acid;hexanedioic acid |
|---|---|
| PubChem CID | 70425971 |
| Molecular Formula | C19H22O14 |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | benzene-1,2,4-tricarboxylic acid;butanedioic acid;hexanedioic acid |
| SMILES | O=C(O)CCC(=O)O.O=C(O)CCCCC(=O)O.O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O6.C6H10O4.C4H6O4/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;7-5(8)3-1-2-4-6(9)10;5-3(6)1-2-4(7)8/h1-3H,(H,10,11)(H,12,13)(H,14,15);1-4H2,(H,7,8)(H,9,10);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | PTEYVPBYOAAFMK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 261.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|