C14H18O11 — CID 175045405
benzene-1,2,4-tricarboxylic acid;pentane-1,2,3,4,5-pentol (PubChem CID 175045405) has the molecular formula C14H18O11 and a molecular weight of 362.29 g/mol. Its IUPAC name is benzene-1,2,4-tricarboxylic acid;pentane-1,2,3,4,5-pentol.
| Compound Name | benzene-1,2,4-tricarboxylic acid;pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 175045405 |
| Molecular Formula | C14H18O11 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | benzene-1,2,4-tricarboxylic acid;pentane-1,2,3,4,5-pentol |
| SMILES | O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1.OCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C9H6O6.C5H12O5/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;6-1-3(8)5(10)4(9)2-7/h1-3H,(H,10,11)(H,12,13)(H,14,15);3-10H,1-2H2 |
| InChIKey | SCHAOZCGUWFANF-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 213.05 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |