C10H12O6 — CID 170818202
4-hydroxy-3-(1,2,3-trihydroxypropyl)benzoic acid (PubChem CID 170818202) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is 4-hydroxy-3-(1,2,3-trihydroxypropyl)benzoic acid.
| Compound Name | 4-hydroxy-3-(1,2,3-trihydroxypropyl)benzoic acid |
|---|---|
| PubChem CID | 170818202 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 4-hydroxy-3-(1,2,3-trihydroxypropyl)benzoic acid |
| SMILES | O=C(O)c1ccc(O)c(C(O)C(O)CO)c1 |
| InChI | InChI=1S/C10H12O6/c11-4-8(13)9(14)6-3-5(10(15)16)1-2-7(6)12/h1-3,8-9,11-14H,4H2,(H,15,16) |
| InChIKey | UCWJYJAANLQZJU-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |