C9H9NO5 — CID 66512316
3-[(S)-amino(carboxy)methyl]-4-hydroxybenzoic acid (PubChem CID 66512316) has the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. Its IUPAC name is 3-[(S)-amino(carboxy)methyl]-4-hydroxybenzoic acid.
| Compound Name | 3-[(S)-amino(carboxy)methyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 66512316 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 3-[(S)-amino(carboxy)methyl]-4-hydroxybenzoic acid |
| SMILES | N[C@H](C(=O)O)c1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C9H9NO5/c10-7(9(14)15)5-3-4(8(12)13)1-2-6(5)11/h1-3,7,11H,10H2,(H,12,13)(H,14,15)/t7-/m0/s1 |
| InChIKey | UTONSYSARMMYSM-ZETCQYMHSA-N |
| XLogP | 0.17 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|