C9H9F2NO3 — CID 84682427
2-amino-2-[5-(difluoromethyl)-2-hydroxyphenyl]acetic acid (PubChem CID 84682427) has the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. Its IUPAC name is 2-amino-2-[5-(difluoromethyl)-2-hydroxyphenyl]acetic acid.
| Compound Name | 2-amino-2-[5-(difluoromethyl)-2-hydroxyphenyl]acetic acid |
|---|---|
| PubChem CID | 84682427 |
| Molecular Formula | C9H9F2NO3 |
| Molecular Weight | 217.17 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-amino-2-[5-(difluoromethyl)-2-hydroxyphenyl]acetic acid |
| SMILES | NC(C(=O)O)c1cc(C(F)F)ccc1O |
| InChI | InChI=1S/C9H9F2NO3/c10-8(11)4-1-2-6(13)5(3-4)7(12)9(14)15/h1-3,7-8,13H,12H2,(H,14,15) |
| InChIKey | DCUDCUZSNLTJJW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|