(2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid

C8H9NO4 — CID 5310986

IUPAC(2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid
SMILESN[C@H](C(=O)O)c1ccc(O)c(O)c1
InChIInChI=1S/C8H9NO4/c9-7(8(12)13)4-1-2-5(10)6(11)3-4/h1-3,7,10-11H,9H2,(H,12,13)/t7-/m0/s1
InChIKeyZBWTWPZGSGMRTG-ZETCQYMHSA-N
MW183.16 g/mol
LogP0.18
Rot. Bonds2

About (2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid

(2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid (PubChem CID 5310986) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is (2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid.

Molecular Properties

Compound Name(2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid
PubChem CID5310986
Molecular FormulaC8H9NO4
Molecular Weight183.16 g/mol
Exact Mass183.05
IUPAC Name(2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid
SMILESN[C@H](C(=O)O)c1ccc(O)c(O)c1
InChIInChI=1S/C8H9NO4/c9-7(8(12)13)4-1-2-5(10)6(11)3-4/h1-3,7,10-11H,9H2,(H,12,13)/t7-/m0/s1
InChIKeyZBWTWPZGSGMRTG-ZETCQYMHSA-N
XLogP0.18
TPSA103.78 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.16
LogP ≤ 50.18
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze (2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid?
The IUPAC name of (2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid (CID 5310986) is (2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid.
What is the SMILES notation for (2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid?
The canonical SMILES for (2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid is N[C@H](C(=O)O)c1ccc(O)c(O)c1.
What is the InChIKey of (2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid?
The InChIKey is ZBWTWPZGSGMRTG-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H9NO4/c9-7(8(12)13)4-1-2-5(10)6(11)3-4/h1-3,7,10-11H,9H2,(H,12,13)/t7-/m0/s1.
What are the key properties of (2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid?
(2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid has a molecular weight of 183.16 g/mol, XLogP of 0.18, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-(3,4-dihydroxyphenyl)acetic acid is sourced from PubChem (CID 5310986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).