C9H12NNaO5 — CID 173371497
sodium;(2S,3S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid;hydride (PubChem CID 173371497) has the molecular formula C9H12NNaO5 and a molecular weight of 237.19 g/mol. Its IUPAC name is sodium;(2S,3S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid;hydride.
| Compound Name | sodium;(2S,3S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid;hydride |
|---|---|
| PubChem CID | 173371497 |
| Molecular Formula | C9H12NNaO5 |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | sodium;(2S,3S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid;hydride |
| SMILES | N[C@H](C(=O)O)[C@@H](O)c1ccc(O)c(O)c1.[H-].[Na+] |
| InChI | InChI=1S/C9H11NO5.Na.H/c10-7(9(14)15)8(13)4-1-2-5(11)6(12)3-4;;/h1-3,7-8,11-13H,10H2,(H,14,15);;/q;+1;-1/t7-,8-;;/m0../s1 |
| InChIKey | BRMJMDMCFBFZKJ-FOMWZSOGSA-N |
| XLogP | -3.34 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|