C15H23N3O6 — CID 18609847
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid;piperidine-1-carboxamide (PubChem CID 18609847) has the molecular formula C15H23N3O6 and a molecular weight of 341.36 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid;piperidine-1-carboxamide.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid;piperidine-1-carboxamide |
|---|---|
| PubChem CID | 18609847 |
| Molecular Formula | C15H23N3O6 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-3-hydroxypropanoic acid;piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCCCC1.N[C@H](C(=O)O)C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H11NO5.C6H12N2O/c10-7(9(14)15)8(13)4-1-2-5(11)6(12)3-4;7-6(9)8-4-2-1-3-5-8/h1-3,7-8,11-13H,10H2,(H,14,15);1-5H2,(H2,7,9)/t7-,8?;/m0./s1 |
| InChIKey | TXINXBPYCUAUPM-JPPWUZRISA-N |
| XLogP | 0.09 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|