C16H24N2O3 — CID 61148033
(2S)-2-amino-1-(azocan-1-yl)-3-(3,4-dihydroxyphenyl)propan-1-one (PubChem CID 61148033) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (2S)-2-amino-1-(azocan-1-yl)-3-(3,4-dihydroxyphenyl)propan-1-one.
| Compound Name | (2S)-2-amino-1-(azocan-1-yl)-3-(3,4-dihydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 61148033 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (2S)-2-amino-1-(azocan-1-yl)-3-(3,4-dihydroxyphenyl)propan-1-one |
| SMILES | N[C@@H](Cc1ccc(O)c(O)c1)C(=O)N1CCCCCCC1 |
| InChI | InChI=1S/C16H24N2O3/c17-13(10-12-6-7-14(19)15(20)11-12)16(21)18-8-4-2-1-3-5-9-18/h6-7,11,13,19-20H,1-5,8-10,17H2/t13-/m0/s1 |
| InChIKey | DZIGRYVPIWDKSX-ZDUSSCGKSA-N |
| XLogP | 1.76 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|