C14H20N2O4 — CID 61148329
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(2-methylmorpholin-4-yl)propan-1-one (PubChem CID 61148329) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(2-methylmorpholin-4-yl)propan-1-one.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(2-methylmorpholin-4-yl)propan-1-one |
|---|---|
| PubChem CID | 61148329 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(2-methylmorpholin-4-yl)propan-1-one |
| SMILES | CC1CN(C(=O)[C@@H](N)Cc2ccc(O)c(O)c2)CCO1 |
| InChI | InChI=1S/C14H20N2O4/c1-9-8-16(4-5-20-9)14(19)11(15)6-10-2-3-12(17)13(18)7-10/h2-3,7,9,11,17-18H,4-6,8,15H2,1H3/t9?,11-/m0/s1 |
| InChIKey | IEBCIESJYAPWFX-UMJHXOGRSA-N |
| XLogP | 0.21 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|