C16H25NO4 — CID 145342224
3-(3,4-dihydroxyphenyl)-1-(2-methylmorpholin-4-yl)propan-1-one;ethane (PubChem CID 145342224) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-1-(2-methylmorpholin-4-yl)propan-1-one;ethane.
| Compound Name | 3-(3,4-dihydroxyphenyl)-1-(2-methylmorpholin-4-yl)propan-1-one;ethane |
|---|---|
| PubChem CID | 145342224 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-1-(2-methylmorpholin-4-yl)propan-1-one;ethane |
| SMILES | CC.CC1CN(C(=O)CCc2ccc(O)c(O)c2)CCO1 |
| InChI | InChI=1S/C14H19NO4.C2H6/c1-10-9-15(6-7-19-10)14(18)5-3-11-2-4-12(16)13(17)8-11;1-2/h2,4,8,10,16-17H,3,5-7,9H2,1H3;1-2H3 |
| InChIKey | ISIOWSGDQUZYLM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|