4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid

C16H21NO4 — CID 82071036

IUPAC4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid
SMILESCC1CN(C(=O)CCc2ccc(C(=O)O)cc2)CC(C)O1
InChIInChI=1S/C16H21NO4/c1-11-9-17(10-12(2)21-11)15(18)8-5-13-3-6-14(7-4-13)16(19)20/h3-4,6-7,11-12H,5,8-10H2,1-2H3,(H,19,20)
InChIKeyYLUYKTHCYOAQHX-UHFFFAOYSA-N
MW291.35 g/mol
LogP1.95
Rot. Bonds4

About 4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid

4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid (PubChem CID 82071036) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid.

Molecular Properties

Compound Name4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid
PubChem CID82071036
Molecular FormulaC16H21NO4
Molecular Weight291.35 g/mol
Exact Mass291.15
IUPAC Name4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid
SMILESCC1CN(C(=O)CCc2ccc(C(=O)O)cc2)CC(C)O1
InChIInChI=1S/C16H21NO4/c1-11-9-17(10-12(2)21-11)15(18)8-5-13-3-6-14(7-4-13)16(19)20/h3-4,6-7,11-12H,5,8-10H2,1-2H3,(H,19,20)
InChIKeyYLUYKTHCYOAQHX-UHFFFAOYSA-N
XLogP1.95
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.35
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid?
The IUPAC name of 4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid (CID 82071036) is 4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid.
What is the SMILES notation for 4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid?
The canonical SMILES for 4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid is CC1CN(C(=O)CCc2ccc(C(=O)O)cc2)CC(C)O1.
What is the InChIKey of 4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid?
The InChIKey is YLUYKTHCYOAQHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c1-11-9-17(10-12(2)21-11)15(18)8-5-13-3-6-14(7-4-13)16(19)20/h3-4,6-7,11-12H,5,8-10H2,1-2H3,(H,19,20).
What are the key properties of 4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid?
4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid has a molecular weight of 291.35 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,6-dimethylmorpholin-4-yl)-3-oxopropyl]benzoic acid is sourced from PubChem (CID 82071036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).