C16H23NO2 — CID 807657
1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-phenylbutan-1-one (PubChem CID 807657) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 807657 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-phenylbutan-1-one |
| SMILES | C[C@@H]1CN(C(=O)CCCc2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C16H23NO2/c1-13-11-17(12-14(2)19-13)16(18)10-6-9-15-7-4-3-5-8-15/h3-5,7-8,13-14H,6,9-12H2,1-2H3/t13-,14+ |
| InChIKey | USQSZQZXLIKUNP-OKILXGFUSA-N |
| XLogP | 2.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |