C18H21NO3 — CID 97324003
4-[3-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-3-oxopropyl]benzoic acid (PubChem CID 97324003) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-[3-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 97324003 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-[3-[(3aR,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-3-oxopropyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCC(=O)N2C[C@H]3CC=CC[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H21NO3/c20-17(19-11-15-3-1-2-4-16(15)12-19)10-7-13-5-8-14(9-6-13)18(21)22/h1-2,5-6,8-9,15-16H,3-4,7,10-12H2,(H,21,22)/t15-,16+ |
| InChIKey | NDLXFJPJCHUEDV-IYBDPMFKSA-N |
| XLogP | 2.74 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|