About (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one (PubChem CID 104876695) has the molecular formula C15H22N2O4
and a molecular weight of 294.35 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one |
| PubChem CID | 104876695 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one |
| SMILES | CC1(O)CCCN(C(=O)[C@@H](N)Cc2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C15H22N2O4/c1-15(21)5-2-6-17(9-15)14(20)11(16)7-10-3-4-12(18)13(19)8-10/h3-4,8,11,18-19,21H,2,5-7,9,16H2,1H3/t11-,15?/m0/s1 |
| InChIKey | UIIZADIRUPKPDG-VPHXOMNUSA-N |
| XLogP | 0.34 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one?
The IUPAC name of (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one (CID 104876695) is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one.
What is the SMILES notation for (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one?
The canonical SMILES for (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one is CC1(O)CCCN(C(=O)[C@@H](N)Cc2ccc(O)c(O)c2)C1.
What is the InChIKey of (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one?
The InChIKey is UIIZADIRUPKPDG-VPHXOMNUSA-N. The full InChI is InChI=1S/C15H22N2O4/c1-15(21)5-2-6-17(9-15)14(20)11(16)7-10-3-4-12(18)13(19)8-10/h3-4,8,11,18-19,21H,2,5-7,9,16H2,1H3/t11-,15?/m0/s1.
What are the key properties of (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one?
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one has a molecular weight of 294.35 g/mol, XLogP of 0.34, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(3,4-dihydroxyphenyl)-1-(3-hydroxy-3-methylpiperidin-1-yl)propan-1-one is sourced from PubChem (CID 104876695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).