C10H11NO6 — CID 171868523
3-(3-amino-1,2-dihydroxy-3-oxopropyl)-4-hydroxybenzoic acid (PubChem CID 171868523) has the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. Its IUPAC name is 3-(3-amino-1,2-dihydroxy-3-oxopropyl)-4-hydroxybenzoic acid.
| Compound Name | 3-(3-amino-1,2-dihydroxy-3-oxopropyl)-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171868523 |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3-(3-amino-1,2-dihydroxy-3-oxopropyl)-4-hydroxybenzoic acid |
| SMILES | NC(=O)C(O)C(O)c1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C10H11NO6/c11-9(15)8(14)7(13)5-3-4(10(16)17)1-2-6(5)12/h1-3,7-8,12-14H,(H2,11,15)(H,16,17) |
| InChIKey | AKGBFMFYTHDLHM-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |