C9H10ClNO4 — CID 171867764
3-(5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropanamide (PubChem CID 171867764) has the molecular formula C9H10ClNO4 and a molecular weight of 231.64 g/mol. Its IUPAC name is 3-(5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171867764 |
| Molecular Formula | C9H10ClNO4 |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 3-(5-chloro-2-hydroxyphenyl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C9H10ClNO4/c10-4-1-2-6(12)5(3-4)7(13)8(14)9(11)15/h1-3,7-8,12-14H,(H2,11,15) |
| InChIKey | FHNLOFVKDCGVHC-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |