C7H8ClNO3S — CID 171867560
3-(2-chlorothiophen-3-yl)-2,3-dihydroxypropanamide (PubChem CID 171867560) has the molecular formula C7H8ClNO3S and a molecular weight of 221.66 g/mol. Its IUPAC name is 3-(2-chlorothiophen-3-yl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(2-chlorothiophen-3-yl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171867560 |
| Molecular Formula | C7H8ClNO3S |
| Molecular Weight | 221.66 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | 3-(2-chlorothiophen-3-yl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1ccsc1Cl |
| InChI | InChI=1S/C7H8ClNO3S/c8-6-3(1-2-13-6)4(10)5(11)7(9)12/h1-2,4-5,10-11H,(H2,9,12) |
| InChIKey | VWZATCSDZADZBL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.66 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |