About 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea
4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea (PubChem CID 146661586) has the molecular formula C13H12Cl2N2O3S
and a molecular weight of 347.22 g/mol. Its IUPAC name is 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea.
Molecular Properties
| Compound Name | 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea |
| PubChem CID | 146661586 |
| Molecular Formula | C13H12Cl2N2O3S |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea |
| SMILES | NC(N)=O.Oc1ccc(Cl)cc1Sc1cc(Cl)ccc1O |
| InChI | InChI=1S/C12H8Cl2O2S.CH4N2O/c13-7-1-3-9(15)11(5-7)17-12-6-8(14)2-4-10(12)16;2-1(3)4/h1-6,15-16H;(H4,2,3,4) |
| InChIKey | UKMVIFGYAJOWEH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea?
The IUPAC name of 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea (CID 146661586) is 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea.
What is the SMILES notation for 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea?
The canonical SMILES for 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea is NC(N)=O.Oc1ccc(Cl)cc1Sc1cc(Cl)ccc1O.
What is the InChIKey of 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea?
The InChIKey is UKMVIFGYAJOWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2O2S.CH4N2O/c13-7-1-3-9(15)11(5-7)17-12-6-8(14)2-4-10(12)16;2-1(3)4/h1-6,15-16H;(H4,2,3,4).
What are the key properties of 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea?
4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea has a molecular weight of 347.22 g/mol, XLogP of 3.58, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(5-chloro-2-hydroxyphenyl)sulfanylphenol;urea is sourced from PubChem (CID 146661586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).