About 2-amino-4-chlorophenol;carbon dioxide
2-amino-4-chlorophenol;carbon dioxide (PubChem CID 160735272) has the molecular formula C7H6ClNO3
and a molecular weight of 187.58 g/mol. Its IUPAC name is 2-amino-4-chlorophenol;carbon dioxide.
Molecular Properties
| Compound Name | 2-amino-4-chlorophenol;carbon dioxide |
| PubChem CID | 160735272 |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.58 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 2-amino-4-chlorophenol;carbon dioxide |
| SMILES | Nc1cc(Cl)ccc1O.O=C=O |
| InChI | InChI=1S/C6H6ClNO.CO2/c7-4-1-2-6(9)5(8)3-4;2-1-3/h1-3,9H,8H2; |
| InChIKey | RUWDIXIKMXLEMF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.58 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-chlorophenol;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-chlorophenol;carbon dioxide?
The IUPAC name of 2-amino-4-chlorophenol;carbon dioxide (CID 160735272) is 2-amino-4-chlorophenol;carbon dioxide.
What is the SMILES notation for 2-amino-4-chlorophenol;carbon dioxide?
The canonical SMILES for 2-amino-4-chlorophenol;carbon dioxide is Nc1cc(Cl)ccc1O.O=C=O.
What is the InChIKey of 2-amino-4-chlorophenol;carbon dioxide?
The InChIKey is RUWDIXIKMXLEMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO.CO2/c7-4-1-2-6(9)5(8)3-4;2-1-3/h1-3,9H,8H2;.
What are the key properties of 2-amino-4-chlorophenol;carbon dioxide?
2-amino-4-chlorophenol;carbon dioxide has a molecular weight of 187.58 g/mol, XLogP of 1.04, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-chlorophenol;carbon dioxide is sourced from PubChem (CID 160735272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).