C10H9ClN2O2 — CID 91897251
1-(2-amino-4-chlorophenyl)pyrrole-2,5-diol (PubChem CID 91897251) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is 1-(2-amino-4-chlorophenyl)pyrrole-2,5-diol.
| Compound Name | 1-(2-amino-4-chlorophenyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91897251 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1-(2-amino-4-chlorophenyl)pyrrole-2,5-diol |
| SMILES | Nc1cc(Cl)ccc1-n1c(O)ccc1O |
| InChI | InChI=1S/C10H9ClN2O2/c11-6-1-2-8(7(12)5-6)13-9(14)3-4-10(13)15/h1-5,14-15H,12H2 |
| InChIKey | DLBYDRMFFCHJMV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|