About 4-amino-2-fluorophenol;carbon dioxide
4-amino-2-fluorophenol;carbon dioxide (PubChem CID 160625037) has the molecular formula C7H6FNO3
and a molecular weight of 171.13 g/mol. Its IUPAC name is 4-amino-2-fluorophenol;carbon dioxide.
Molecular Properties
| Compound Name | 4-amino-2-fluorophenol;carbon dioxide |
| PubChem CID | 160625037 |
| Molecular Formula | C7H6FNO3 |
| Molecular Weight | 171.13 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | 4-amino-2-fluorophenol;carbon dioxide |
| SMILES | Nc1ccc(O)c(F)c1.O=C=O |
| InChI | InChI=1S/C6H6FNO.CO2/c7-5-3-4(8)1-2-6(5)9;2-1-3/h1-3,9H,8H2; |
| InChIKey | RHEONFLCIGSDMJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.13 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-fluorophenol;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-fluorophenol;carbon dioxide?
The IUPAC name of 4-amino-2-fluorophenol;carbon dioxide (CID 160625037) is 4-amino-2-fluorophenol;carbon dioxide.
What is the SMILES notation for 4-amino-2-fluorophenol;carbon dioxide?
The canonical SMILES for 4-amino-2-fluorophenol;carbon dioxide is Nc1ccc(O)c(F)c1.O=C=O.
What is the InChIKey of 4-amino-2-fluorophenol;carbon dioxide?
The InChIKey is RHEONFLCIGSDMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO.CO2/c7-5-3-4(8)1-2-6(5)9;2-1-3/h1-3,9H,8H2;.
What are the key properties of 4-amino-2-fluorophenol;carbon dioxide?
4-amino-2-fluorophenol;carbon dioxide has a molecular weight of 171.13 g/mol, XLogP of 0.53, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-fluorophenol;carbon dioxide is sourced from PubChem (CID 160625037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).