C6H8FO6P — CID 131985559
2-fluorobenzene-1,4-diol;phosphoric acid (PubChem CID 131985559) has the molecular formula C6H8FO6P and a molecular weight of 226.10 g/mol. Its IUPAC name is 2-fluorobenzene-1,4-diol;phosphoric acid.
| Compound Name | 2-fluorobenzene-1,4-diol;phosphoric acid |
|---|---|
| PubChem CID | 131985559 |
| Molecular Formula | C6H8FO6P |
| Molecular Weight | 226.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 2-fluorobenzene-1,4-diol;phosphoric acid |
| SMILES | O=P(O)(O)O.Oc1ccc(O)c(F)c1 |
| InChI | InChI=1S/C6H5FO2.H3O4P/c7-5-3-4(8)1-2-6(5)9;1-5(2,3)4/h1-3,8-9H;(H3,1,2,3,4) |
| InChIKey | XDTVZQIHUHDKCB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.10 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|