About carbon dioxide;4-ethyl-3-fluoroaniline
carbon dioxide;4-ethyl-3-fluoroaniline (PubChem CID 158926193) has the molecular formula C9H10FNO2
and a molecular weight of 183.18 g/mol. Its IUPAC name is carbon dioxide;4-ethyl-3-fluoroaniline.
Molecular Properties
| Compound Name | carbon dioxide;4-ethyl-3-fluoroaniline |
| PubChem CID | 158926193 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | carbon dioxide;4-ethyl-3-fluoroaniline |
| SMILES | CCc1ccc(N)cc1F.O=C=O |
| InChI | InChI=1S/C8H10FN.CO2/c1-2-6-3-4-7(10)5-8(6)9;2-1-3/h3-5H,2,10H2,1H3; |
| InChIKey | JILXACTXJCHJRO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;4-ethyl-3-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;4-ethyl-3-fluoroaniline?
The IUPAC name of carbon dioxide;4-ethyl-3-fluoroaniline (CID 158926193) is carbon dioxide;4-ethyl-3-fluoroaniline.
What is the SMILES notation for carbon dioxide;4-ethyl-3-fluoroaniline?
The canonical SMILES for carbon dioxide;4-ethyl-3-fluoroaniline is CCc1ccc(N)cc1F.O=C=O.
What is the InChIKey of carbon dioxide;4-ethyl-3-fluoroaniline?
The InChIKey is JILXACTXJCHJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN.CO2/c1-2-6-3-4-7(10)5-8(6)9;2-1-3/h3-5H,2,10H2,1H3;.
What are the key properties of carbon dioxide;4-ethyl-3-fluoroaniline?
carbon dioxide;4-ethyl-3-fluoroaniline has a molecular weight of 183.18 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;4-ethyl-3-fluoroaniline is sourced from PubChem (CID 158926193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).