C11H17FN2 — CID 64768064
3-fluoro-4-[[methyl(propyl)amino]methyl]aniline (PubChem CID 64768064) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is 3-fluoro-4-[[methyl(propyl)amino]methyl]aniline.
| Compound Name | 3-fluoro-4-[[methyl(propyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 64768064 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 3-fluoro-4-[[methyl(propyl)amino]methyl]aniline |
| SMILES | CCCN(C)Cc1ccc(N)cc1F |
| InChI | InChI=1S/C11H17FN2/c1-3-6-14(2)8-9-4-5-10(13)7-11(9)12/h4-5,7H,3,6,8,13H2,1-2H3 |
| InChIKey | QFKNBBLBYJFJCK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|