C13H7Cl3O2 — CID 58962676
(5-chloro-2-hydroxyphenyl)-(3,5-dichlorophenyl)methanone (PubChem CID 58962676) has the molecular formula C13H7Cl3O2 and a molecular weight of 301.56 g/mol. Its IUPAC name is (5-chloro-2-hydroxyphenyl)-(3,5-dichlorophenyl)methanone.
| Compound Name | (5-chloro-2-hydroxyphenyl)-(3,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 58962676 |
| Molecular Formula | C13H7Cl3O2 |
| Molecular Weight | 301.56 g/mol |
| Exact Mass | 299.95 |
| IUPAC Name | (5-chloro-2-hydroxyphenyl)-(3,5-dichlorophenyl)methanone |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C13H7Cl3O2/c14-8-1-2-12(17)11(6-8)13(18)7-3-9(15)5-10(16)4-7/h1-6,17H |
| InChIKey | NIFPFORIULRSRR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |