methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate

C11H13ClO5 — CID 171862640

IUPACmethyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate
SMILESCOC(=O)c1ccc(O)c(C(O)C(O)CCl)c1
InChIInChI=1S/C11H13ClO5/c1-17-11(16)6-2-3-8(13)7(4-6)10(15)9(14)5-12/h2-4,9-10,13-15H,5H2,1H3
InChIKeyVVZCFWNEKUBDFK-UHFFFAOYSA-N
MW260.67 g/mol
LogP0.81
Rot. Bonds4

About methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate

methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate (PubChem CID 171862640) has the molecular formula C11H13ClO5 and a molecular weight of 260.67 g/mol. Its IUPAC name is methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate.

Molecular Properties

Compound Namemethyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate
PubChem CID171862640
Molecular FormulaC11H13ClO5
Molecular Weight260.67 g/mol
Exact Mass260.05
IUPAC Namemethyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate
SMILESCOC(=O)c1ccc(O)c(C(O)C(O)CCl)c1
InChIInChI=1S/C11H13ClO5/c1-17-11(16)6-2-3-8(13)7(4-6)10(15)9(14)5-12/h2-4,9-10,13-15H,5H2,1H3
InChIKeyVVZCFWNEKUBDFK-UHFFFAOYSA-N
XLogP0.81
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.67
LogP ≤ 50.81
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate?
The IUPAC name of methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate (CID 171862640) is methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate.
What is the SMILES notation for methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate?
The canonical SMILES for methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate is COC(=O)c1ccc(O)c(C(O)C(O)CCl)c1.
What is the InChIKey of methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate?
The InChIKey is VVZCFWNEKUBDFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO5/c1-17-11(16)6-2-3-8(13)7(4-6)10(15)9(14)5-12/h2-4,9-10,13-15H,5H2,1H3.
What are the key properties of methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate?
methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate has a molecular weight of 260.67 g/mol, XLogP of 0.81, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate is sourced from PubChem (CID 171862640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).