C11H13ClO5 — CID 171862640
methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate (PubChem CID 171862640) has the molecular formula C11H13ClO5 and a molecular weight of 260.67 g/mol. Its IUPAC name is methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate.
| Compound Name | methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate |
|---|---|
| PubChem CID | 171862640 |
| Molecular Formula | C11H13ClO5 |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | methyl 3-(3-chloro-1,2-dihydroxypropyl)-4-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(O)c(C(O)C(O)CCl)c1 |
| InChI | InChI=1S/C11H13ClO5/c1-17-11(16)6-2-3-8(13)7(4-6)10(15)9(14)5-12/h2-4,9-10,13-15H,5H2,1H3 |
| InChIKey | VVZCFWNEKUBDFK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|