C12H13NO5 — CID 171902116
methyl 4-(3-cyano-1,2-dihydroxypropyl)-3-hydroxybenzoate (PubChem CID 171902116) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is methyl 4-(3-cyano-1,2-dihydroxypropyl)-3-hydroxybenzoate.
| Compound Name | methyl 4-(3-cyano-1,2-dihydroxypropyl)-3-hydroxybenzoate |
|---|---|
| PubChem CID | 171902116 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | methyl 4-(3-cyano-1,2-dihydroxypropyl)-3-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(C(O)C(O)CC#N)c(O)c1 |
| InChI | InChI=1S/C12H13NO5/c1-18-12(17)7-2-3-8(10(15)6-7)11(16)9(14)4-5-13/h2-3,6,9,11,14-16H,4H2,1H3 |
| InChIKey | XYZBXYVUMSEGSY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |