C11H11NO5 — CID 171901327
4-(3-cyano-1,2-dihydroxypropyl)-3-hydroxybenzoic acid (PubChem CID 171901327) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is 4-(3-cyano-1,2-dihydroxypropyl)-3-hydroxybenzoic acid.
| Compound Name | 4-(3-cyano-1,2-dihydroxypropyl)-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171901327 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-(3-cyano-1,2-dihydroxypropyl)-3-hydroxybenzoic acid |
| SMILES | N#CCC(O)C(O)c1ccc(C(=O)O)cc1O |
| InChI | InChI=1S/C11H11NO5/c12-4-3-8(13)10(15)7-2-1-6(11(16)17)5-9(7)14/h1-2,5,8,10,13-15H,3H2,(H,16,17) |
| InChIKey | FKISCKSMNHMOBC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |