C10H9ClN2O4 — CID 171901389
6-chloro-3-(3-cyano-1,2-dihydroxypropyl)pyridine-2-carboxylic acid (PubChem CID 171901389) has the molecular formula C10H9ClN2O4 and a molecular weight of 256.64 g/mol. Its IUPAC name is 6-chloro-3-(3-cyano-1,2-dihydroxypropyl)pyridine-2-carboxylic acid.
| Compound Name | 6-chloro-3-(3-cyano-1,2-dihydroxypropyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 171901389 |
| Molecular Formula | C10H9ClN2O4 |
| Molecular Weight | 256.64 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 6-chloro-3-(3-cyano-1,2-dihydroxypropyl)pyridine-2-carboxylic acid |
| SMILES | N#CCC(O)C(O)c1ccc(Cl)nc1C(=O)O |
| InChI | InChI=1S/C10H9ClN2O4/c11-7-2-1-5(8(13-7)10(16)17)9(15)6(14)3-4-12/h1-2,6,9,14-15H,3H2,(H,16,17) |
| InChIKey | RWFRZVTWRNQPIA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.64 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|