C9H11ClN2O4 — CID 170828444
3-(3-amino-1,2-dihydroxypropyl)-6-chloropyridine-2-carboxylic acid (PubChem CID 170828444) has the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. Its IUPAC name is 3-(3-amino-1,2-dihydroxypropyl)-6-chloropyridine-2-carboxylic acid.
| Compound Name | 3-(3-amino-1,2-dihydroxypropyl)-6-chloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 170828444 |
| Molecular Formula | C9H11ClN2O4 |
| Molecular Weight | 246.65 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 3-(3-amino-1,2-dihydroxypropyl)-6-chloropyridine-2-carboxylic acid |
| SMILES | NCC(O)C(O)c1ccc(Cl)nc1C(=O)O |
| InChI | InChI=1S/C9H11ClN2O4/c10-6-2-1-4(7(12-6)9(15)16)8(14)5(13)3-11/h1-2,5,8,13-14H,3,11H2,(H,15,16) |
| InChIKey | KVWSZYXRQYIFLP-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.65 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|