C12H13ClN2O2 — CID 170828786
3-amino-1-(2-chloroquinolin-6-yl)propane-1,2-diol (PubChem CID 170828786) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 3-amino-1-(2-chloroquinolin-6-yl)propane-1,2-diol.
| Compound Name | 3-amino-1-(2-chloroquinolin-6-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 170828786 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-amino-1-(2-chloroquinolin-6-yl)propane-1,2-diol |
| SMILES | NCC(O)C(O)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C12H13ClN2O2/c13-11-4-2-7-5-8(1-3-9(7)15-11)12(17)10(16)6-14/h1-5,10,12,16-17H,6,14H2 |
| InChIKey | VNDCDJILSAQMMR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|