C11H14N2O2 — CID 170828204
3-amino-1-(1H-indol-6-yl)propane-1,2-diol (PubChem CID 170828204) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-amino-1-(1H-indol-6-yl)propane-1,2-diol.
| Compound Name | 3-amino-1-(1H-indol-6-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 170828204 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-amino-1-(1H-indol-6-yl)propane-1,2-diol |
| SMILES | NCC(O)C(O)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C11H14N2O2/c12-6-10(14)11(15)8-2-1-7-3-4-13-9(7)5-8/h1-5,10-11,13-15H,6,12H2 |
| InChIKey | LCLNOQOOBPPUPF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |