C10H10F2N2 — CID 130708718
(1S)-2,2-difluoro-1-(1H-indol-6-yl)ethanamine (PubChem CID 130708718) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is (1S)-2,2-difluoro-1-(1H-indol-6-yl)ethanamine.
| Compound Name | (1S)-2,2-difluoro-1-(1H-indol-6-yl)ethanamine |
|---|---|
| PubChem CID | 130708718 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (1S)-2,2-difluoro-1-(1H-indol-6-yl)ethanamine |
| SMILES | N[C@@H](c1ccc2cc[nH]c2c1)C(F)F |
| InChI | InChI=1S/C10H10F2N2/c11-10(12)9(13)7-2-1-6-3-4-14-8(6)5-7/h1-5,9-10,14H,13H2/t9-/m0/s1 |
| InChIKey | INFXYYPZMVOYLD-VIFPVBQESA-N |
| XLogP | 2.43 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |