C11H12F2N2 — CID 131447167
(1R)-3,3-difluoro-1-(1H-indol-6-yl)propan-1-amine (PubChem CID 131447167) has the molecular formula C11H12F2N2 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1R)-3,3-difluoro-1-(1H-indol-6-yl)propan-1-amine.
| Compound Name | (1R)-3,3-difluoro-1-(1H-indol-6-yl)propan-1-amine |
|---|---|
| PubChem CID | 131447167 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (1R)-3,3-difluoro-1-(1H-indol-6-yl)propan-1-amine |
| SMILES | N[C@H](CC(F)F)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C11H12F2N2/c12-11(13)6-9(14)8-2-1-7-3-4-15-10(7)5-8/h1-5,9,11,15H,6,14H2/t9-/m1/s1 |
| InChIKey | VGRVFEYCQYZQKR-SECBINFHSA-N |
| XLogP | 2.82 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |